MBIMPH F-Analog 2
Cell permeable, potent and selective class IIb HDAC6 inhibitor (IC50 =5nM). Displays high selectivity over all other HDACs (IC50=0.2-11µM). Induces cellular alpha-tubulin, but not histone H3 hyperacetylation in Neuro-2a cells. Promotes mitochondrial transport. Shows improved kinetics and biochemical potency against HDAC6 compared to tubastatin A (AG-CR1-3900). HDAC6 deacetylates tubulin, HSP90 and the core histones (H2A, H2B, H3, H4). Histone deacetylases act via the formation of large multiprotein complexes. HDAC6 plays an important role in microtubule-dependent cell motility, transcriptional regulation, degradation of misfolded proteins and cell cycle and is involved in autophagy, inflammation, cancer and neurodegeneration.
| Catalog Number | AG-CR1-3909-M005 |
| Alternative Name(s) | MBIMPH Fluorinated Analog 2; 4-((6-Fluoro-2-methyl-1H-benzo[d]imidazol-1-yl)methyl)-N-hydroxybenzamide |
| Research Area | Biochemicals, Cancer, Inflammation, Neurodegenerative Disease |
| Molecular Formula | C16H14FN3O2 |
| Purity | >95% |
| Inchi | InChI=1S/C16H14FN3O2/c1-10-18-14-7-6-13(17)8-15(14)20(10)9-11-2-4-12(5-3-11)16(21)19-22/h2-8,22H,9H2,1H3,(H,19,21) |
| Inchi Key | QFZFFNKSKDGHQP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(F)C=C2)N1CC1=CC=C(C=C1)C(=O)NO |
| Size | 5 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3909/mbimph-f-analog-2.html |
