(25S)-delta7-Dafachronic acid [UPF-1404]
Ligand of DAF-12, an orphan nuclear receptor, that regulates dauer diapause, reproductive development, fat metabolism, and life span (life cycle) in parasitic nematodes. Sterol-derived hormone. Blocks formation of infective larvae in several parasitic nematodes. Inhibits the dauer-promoting activity of DAF-12. Supports the reproductive development.
| Catalog Number | AG-CN2-0014-C100 |
| Alternative Name(s) | UPF-1404 |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C27H42O3 |
| CAS# | 949004-12-0 |
| Purity | >95% |
| Inchi | 1S/C27H42O3/c1-17(6-5-7-18(2)25(29)30)22-10-11-23-21-9-8-19-16-20(28)12-14-26(19,3)24(21)13-15-27(22,23)4/h9,17-19,22-24H,5-8,10-16H2,1-4H3,(H,29,30)/t17-,18?,19?,22-,23?,24?,26+,27-/m1/s1 |
| Inchi Key | SQTAVUCHOVVOFD-AAVWLPFVSA-N |
| SMILES | C[C@H](CCC[C@H](C)C(O)=O)[C@H]1CCC2C3=CCC4CC(=O)CC[C@]4(C)C3CC[C@]12C |
| Size | 100 µg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0014/-25s-delta-7-dafachronic-acid.html |