Ibrutinib
Potent and highly selective Bruton’s tyrosine kinase (BTK) inhibitor. Orally bioavailable and irreversible inhibitor of BTK (IC50 = 0.5 nM) with antineoplastic activity. Binds to and irreversibly inhibits BTK activity, preventing B cell activation and B cell-mediated signaling. This leads to an inhibition of the growth of malignant B cells that overexpress BTK. Shown to inhibit autophosphorylation of BTK (IC50 = 11nM), phosphorylation of PLCgamma (IC50 = 29nM), a substrate of BTK and phosphorylation of ERK (IC50 = 13nM).
| Catalog Number | AG-CR1-3620-M025 |
| Alternative Name(s) | PCI-32765 |
| Research Area | Biochemicals, Cancer, Immunology |
| Molecular Formula | C25H24N6O2 |
| CAS# | 936563-96-1 |
| Purity | >98% |
| Inchi | InChI=1S/C25H24N6O2/c1-2-21(32)30-14-6-7-18(15-30)31-25-22(24(26)27-16-28-25)23(29-31)17-10-12-20(13-11-17)33-19-8-4-3-5-9-19/h2-5,8-13,16,18H,1,6-7,14-15H2,(H2,26,27,28)/t18-/m1/s1 |
| Inchi Key | XYFPWWZEPKGCCK-GOSISDBHSA-N |
| SMILES | NC1=C2C(=NC=N1)N(N=C2C1=CC=C(OC2=CC=CC=C2)C=C1)C1CCCN(C1)C(=O)C=C |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3620/ibrutinib.html |
