Ohira-Bestmann Reagent
Used in the Seyferth-Gilbert homologation which is a chemical reaction of an aryl ketone or aldehyde with dimethyl- or diazomethyl-phosphonate and potassium tert-butoxide to give substituted alkynes.
| Catalog Number | CDX-D0501-G001 |
| Alternative Name(s) | Dimethyl (1-diazo-2-oxopropyl)phosphonate; Ohira-Bestmann phosphonate; alpha-Azido-alpha-(dimethyl phosphono)acetone |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C5H9N2O4P |
| CAS# | 90965-06-3 |
| Purity | >96% |
| Inchi | InChI=1S/C5H9N2O4P/c1-4(8)5(7-6)12(9,10-2)11-3/h1-3H3 |
| Inchi Key | SQHSJJGGWYIFCD-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)C(=[N+]=[N-])C(C)=O |
| Size | 1 g |
| Supplier Page | http://www.adipogen.com/cdx-d0501/ohira-bestmann-reagent.html |