Empagliflozin
Antidiabetic agent. Potent and selective sodium glucose co-transporter 2 (SGLT-2) inhibitor. >300-fold selectivity over SGLT-1, 4, 5 and 6. SGLT-2 is found almost exclusively in the proximal tubules of nephronic components in kidneys. Inhibition of SGLT-2 reduces blood glucose by blocking renal glucose reabsorption and thereby increasing urinary glucose excretion (UGE). Shown to preserves beta cell mass and restore glucose homeostasis.
| Catalog Number | AG-CR1-3619-M010 |
| Alternative Name(s) | Jardiance; BI-10773; (2S,3R,4R,5S,6R)-2-[4-Chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Research Area | Biochemicals, Metabolism, Obesity |
| Molecular Formula | C23H27ClO7 |
| CAS# | 864070-44-0 |
| Purity | >98% |
| Inchi | InChI=1S/C23H27ClO7/c24-18-6-3-14(23-22(28)21(27)20(26)19(11-25)31-23)10-15(18)9-13-1-4-16(5-2-13)30-17-7-8-29-12-17/h1-6,10,17,19-23,25-28H,7-9,11-12H2/t17-,19+,20+,21-,22+,23-/m0/s1 |
| Inchi Key | OBWASQILIWPZMG-QZMOQZSNSA-N |
| SMILES | OCC1O[C@H](C(O)[C@@H](O)[C@@H]1O)C1=CC(CC2=CC=C(O[C@H]3CCOC3)C=C2)=C(Cl)C=C1 |
| Size | 10 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3619/empagliflozin.html |
