Concanamycin A (high purity)
Antibiotic. More potent and specific H+-ATPase inhibitor than bafilomycin A1 (Prod. No. BVT-0252). Inhibits acidification of organelles such as lysosomes and the Golgi apparatus. Inhibitor of autophagic degradation by rising lysosomal pH and thus inactivating the lysosomal acid hydrolases. Blocks cell surface expression of viral glycoproteins without affecting their synthesis. Cytotoxic in a number of cell lines in a cell viability assay. Induces nitric oxide (NO) production.
| Catalog Number | BVT-0237-C025 |
| Alternative Name(s) | Folimycin; Antibiotic TAN 1323B; Antibiotic X4357B |
| Research Area | Antibiotic, Autophagy, Cancer, Immunology, Natural Products |
| Molecular Formula | C46H75NO14 |
| CAS# | 80890-47-7 |
| Purity | >98% |
| Inchi | InChI=1S/C46H75NO14/c1-13-16-34-28(7)37(58-38-22-33(48)43(31(10)57-38)60-45(47)53)23-46(54,61-34)30(9)41(51)29(8)42-35(55-11)18-15-17-24(3)19-26(5)39(49)32(14-2)40(50)27(6)20-25(4)21-36(56-12)44(52)59-42/h13,15-18,20-21,26-35,37-43,48-51,54H,14,19,22-23H2,1-12H3,(H2,47,53)/b16-13+,18-15+,24-17-,25-20+,36-21-/t26-,27-,28-,29+,30+,31-,32+,33-,34-,35?,37-,38+,39+,40-,41-,42+,43-,46-/m1/s1 |
| Inchi Key | DJZCTUVALDDONK-MSPZYORZSA-N |
| SMILES | [H][C@@]1(C[C@@H](O)[C@H](OC(N)=O)[C@@H](C)O1)O[C@@H]1C[C@@](O)(O[C@H](C=CC)[C@H]1C)[C@@H](C)[C@H](O)[C@H](C)[C@]1([H])OC(=O)C(OC)=CC(C)=C[C@@H](C)[C@@H](O)[C@@H](CC)[C@@H](O)[C@H](C)CC(C)=CC=C[C@@H]1OC |
| Size | 25 µg |
| Supplier Page | http://www.adipogen.com/bvt-0237/concanamycin-a.html |
