Amorfrutin A
Antidiabetic agent. Potent and selective partial agonist of peroxisome proliferator-activated receptor gamma (PPARgamma), a nuclear receptor regulating lipid and glucose metabolism. Has nanomolar binding affinity to PPARgamma and micromolar binding to the isotypes PPARalpha and PPARbeta/delta. Glucose-lowering agent. Improves insulin sensitivity, glucose tolerance and blood lipid variables without increase of fat storage or hepatoxicity. Shows potent PPARgamma-dependent anti-inflammatory activity. Potent NF-kappaB activation inhibitor by the suppression of IkappaBalpha degradation, p65 nuclear translocation and DNA-binding activity. Antimicrobial agent.
| Catalog Number | 21106 |
| Alternative Name(s) | Amorfrutin 1 |
| Molecular Formula | C21H24O4 |
| CAS# | 80489-90-3 |
| Purity | ≥97% |
| Inchi | InChI=1S/C21H24O4/c1-14(2)9-12-17-18(25-3)13-16(19(20(17)22)21(23)24)11-10-15-7-5-4-6-8-15/h4-9,13,22H,10-12H2,1-3H3,(H,23,24) |
| Inchi Key | CTNFTPUIYFUXBE-UHFFFAOYSA-N |
| SMILES | OC(C(C(O)=C(C/C=C(C)/C)C(OC)=C1)=C1CCC2=CC=CC=C2)=O |
| Size | 500 µg |
| Supplier Page | https://www.caymanchem.com/product/21106 |
