Sipholenol A
Efficient inhibitor of P-glycoprotein (Pgp, MDR-1) function through direct interactions. By inhibiting MDR-1, active compounds remain in the cytoplasm longer and allowing them to be more effective within the cell. Reversing agent for the treatment of multidrug resistance (MDR) in Pgp-overexpressing tumors. Potentiates the cytotoxicity of established P-gp substrates such as colchicine, vinblastine and paclitaxel. Antiproliferative and cytotoxic compound. Potent antifouling compound.
| Catalog Number | AG-CN2-0506-C100 |
| Alternative Name(s) | NSC378977 |
| Research Area | Biochemicals, Cancer, Natural Products |
| Molecular Formula | C30H52O4 |
| CAS# | 78518-73-7 |
| Purity | >98% |
| Inchi | InChI=1S/C30H52O4/c1-19-9-10-22-21(13-17-29(22,7)32)26(2,3)20(19)11-12-23-28(6)16-14-24(31)27(4,5)34-25(28)15-18-30(23,8)33/h9,20-25,31-33H,10-18H2,1-8H3/t20-,21+,22+,23+,24+,25+,28+,29+,30-/m0/s1 |
| Inchi Key | LVWWPNAIMBYRKG-KOHQYJKCSA-N |
| SMILES | CC(O1)(C)[C@H](O)CC[C@@]2(C)[C@@]1([H])CC[C@@](O)(C)[C@@H]2CC[C@@H]3C(C)(C)[C@@](CC[C@@]4(C)O)([H])[C@@]4([H])CC=C3C |
| Size | 100 µg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0506/sipholenol-a.html |
