CPM
Widely used blue fluorescent thiol-reactive dye (Ex/Em: 384/470nm). This maleimide derivative of coumarin is essentially non-fluorescent until it reacts with thiols, making it possible to quantify thiols without a separation step. Good energy acceptor from tryptophan and a good energy donor to fluorescein. Used to monitor release of thiols and to distinguish proliferating cancer cells by nucleolar protein staining.
| Catalog Number | CDX-D0042-M050 |
| Alternative Name(s) | 7-Diethylamino-3-(4-maleimidylphenyl)-4-methylcoumarin |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C24H22N2O4 |
| CAS# | 76877-33-3 |
| Purity | >95% |
| Inchi | InChI=1S/C24H22N2O4/c1-4-25(5-2)18-10-11-19-15(3)23(24(29)30-20(19)14-18)16-6-8-17(9-7-16)26-21(27)12-13-22(26)28/h6-14H,4-5H2,1-3H3 |
| Inchi Key | YGIABALXNBVHBX-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C(C)=C(C(=O)O2)C1=CC=C(C=C1)N1C(=O)C=CC1=O |
| Size | 50 mg |
| Supplier Page | http://www.adipogen.com/cdx-d0042/cpm.html |
