Latrunculin A
Cell permeable marine toxin. Disrupts microfilament-mediated processes. Actin polymerization inhibitor in vitro and in vivo by the formation of a 1:1 complex with monomeric G-actin. Depolymerizes actin filaments (F-actin). Potent phagocytosis inhibitor. Anticancer compound. Suppresses hypoxia-induced HIF-1 activation in tumor cells. Inhibits tumor cell invasion. Acts via a different mechanism than cytochalasins.
| Catalog Number | AG-CN2-0027-C100 |
| Alternative Name(s) | LAT-A; NSC 613011 |
| Research Area | Apoptosis, Cancer, Cell Death, Natural Products |
| Molecular Formula | C22H31NO5S |
| CAS# | 76343-93-6 |
| Purity | >96% |
| Inchi | InChI=1S/C22H31NO5S/c1-15-7-5-3-4-6-8-16(2)11-20(24)27-18-12-17(10-9-15)28-22(26,13-18)19-14-29-21(25)23-19/h3-5,7,11,15,17-19,26H,6,8-10,12-14H2,1-2H3,(H,23,25)/b4-3+,7-5-,16-11-/t15-,17-,18-,19+,22-/m1/s1 |
| Inchi Key | DDVBPZROPPMBLW-IZGXTMSKSA-N |
| SMILES | O=C(SC1)N[C@]1([H])[C@](C2)(O)O[C@@H](C[C@H]2O3)CC[C@H](C)/C=CC=CCC/C(C)=CC3=O |
| Size | 100 µg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0027/latrunculin-a.html |