Lovastatin
Statin compound. Potent competitive HMG-CoA reductase inhibitor. Anti-hypercholesterolemic agent. Cholesterol/isoprenoid biosynthesis inhibitor. Blocks the production of mevalonate, a critical compound in the production of cholesterol and isoprenoids. Inhibits the isoprenylation of Ras and Rho family GTPases. Causes cell cycle arrest in G1 and G2/M phases through modulation of proteasome in cancer cell lines. Smooth muscle cell proliferation inhibitor. Apoptosis inducer. Anticancer compound. Anti-adhesive, immunomodulatory and anti-inflammatory compound. Stimulates bone formation. Increases cellular resistance to anticancer agents such as doxorubicin and etoposide (Prod. No. AG-CR1-3572 http://www.adipogen.com/ag-cr1-3572/etoposide.html ). Suppresses ICAM-1-LFA-1 interactions, which blocks virus replication and infection. Anti-hypertensive agent. Suppresses TNF-induced NF-kappaB activation. Modulates key cell signaling pathways, like Ras, MAPK and EGFR (modest).
| Catalog Number | AG-CN2-0051-M025 |
| Alternative Name(s) | Mevilonin; MK-803; 6-alpha-Methylcompactin; BRN 3631989 |
| Research Area | Apoptosis, Biochemicals, Bone Research, Cancer, Cell Death, Immunology, Inflammation, Metabolism, Natural Products |
| Molecular Formula | C24H36O5 |
| CAS# | 75330-75-5 |
| Purity | >98% |
| Inchi | InChI=1S/C24H36O5/c1-5-15(3)24(27)29-21-11-14(2)10-17-7-6-16(4)20(23(17)21)9-8-19-12-18(25)13-22(26)28-19/h6-7,10,14-16,18-21,23,25H,5,8-9,11-13H2,1-4H3/t14-,15-,16-,18+,19+,20-,21-,23-/m0/s1 |
| Inchi Key | PCZOHLXUXFIOCF-BXMDZJJMSA-N |
| SMILES | [H][C@]12[C@H](C[C@@H](C)C=C1C=C[C@H](C)[C@@H]2CC[C@@H]1C[C@@H](O)CC(=O)O1)OC(=O)[C@@H](C)CC |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0051/lovastatin.html |
