Borrelidin
Macrolide antibiotic. Bacterial, protozoan and mammalian threonyl-tRNA synthetase (THrRS) inhibitor. Antiangiogenic (IC50 = 0.8 nM) and anticancer agent. Induces the collapse of formed capillary tubes in a dose-dependent fashion. In HUVECs, the capillary tube collapsing activity is mediated by the activation of caspases-3 and -8 and induction of apoptosis. Blocks the formation of spontaneous lung metastases of B16-BL6 melanoma cells. Cyclin-dependent kinase (CDK) inhibitor. Antiviral. Potent antimalarial agent (IC50 = 0.97 nM). Inhibitor of potato scab disease.
| Catalog Number | BVT-0098-C500 |
| Alternative Name(s) | Treponemycin; U 78548; C2989 |
| Research Area | Antibiotic, Apoptosis, Cancer, Cell Death, Immunology, Natural Products |
| Molecular Formula | C28H43NO6 |
| CAS# | 7184-60-3 |
| Purity | >98% |
| Inchi | InChI=1S/C28H43NO6/c1-17-12-18(2)14-20(4)27(32)21(16-29)8-5-6-11-25(22-9-7-10-23(22)28(33)34)35-26(31)15-24(30)19(3)13-17/h5-6,8,17-20,22-25,27,30,32H,7,9-15H2,1-4H3,(H,33,34)/b6-5+,21-8-/t17-,18+,19-,20-,22+,23?,24-,25-,27+/m0/s1 |
| Inchi Key | OJCKRNPLOZHAOU-TVHKGLGPSA-N |
| SMILES | [H][C@]1(CCC[C@H]1C(O)=O)[C@]1([H])CC=CC=C(C#N)/[C@H](O)[C@@H](C)C[C@H](C)C[C@H](C)C[C@H](C)[C@@H](O)CC(=O)O1 |
| Size | 500 µg |
| Supplier Page | http://www.adipogen.com/bvt-0098/borrelidin.html |