13-cis-4-Oxoretinoic acid
Mayor active metabolites of 13-cis-retinoic acid (important drug in dermatology and treatment of neuroblastoma) with effects on gene transcription that regulate growth, differentiation and inflammation in normal and neoplastic skin cells. Shown to be as active as 13-cis-retinoic acid against neuroblastoma cell lines. Can be used as reference compound.
| Catalog Number | CDX-O0048-M005 |
| Alternative Name(s) | 4-Oxoisotretinoin; Ro 22-6595 |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C20H26O3 |
| CAS# | 71748-58-8 |
| Purity | >98% |
| Inchi | InChI=1S/C20H26O3/c1-14(7-6-8-15(2)13-19(22)23)9-10-17-16(3)18(21)11-12-20(17,4)5/h6-10,13H,11-12H2,1-5H3,(H,22,23)/b8-6+,10-9+,14-7+,15-13- |
| Inchi Key | GGCUJPCCTQNTJF-FAOQNJJDSA-N |
| SMILES | CC(C=CC1=C(C)C(=O)CCC1(C)C)=C/C=C/C(/C)=CC(O)=O |
| Size | 5 mg |
| Supplier Page | http://www.adipogen.com/cdx-o0048/13-cis-4-oxoretinoic-acid.html |
