5-Hydroxydiclofenac
Metabolite of Diclofenac, a nonsteroidal anti-inflammatory compound that functions via inhibiton of cyclooxygenase (COX). Diclofenac undergoes biotransformation not only by glucuronidation, but also by cytochrome P450–mediated oxidation to produce 4′-OH-DFN and 5-OH-DFN, which undergo subsequent oxidation to form highly electrophilic benzoquinone imine intermediates. Compound can be used as analytical reference material.
| Catalog Number | CDX-H0053-M001 |
| Alternative Name(s) | 2-[(2,6-Dichlorophenyl)amino]-5-hydroxybenzeneacetic acid; 5-OH-DFN; 5-OH DCF; BRN4199419 |
| Research Area | Biochemicals, Immunology, Inflammation |
| Molecular Formula | C14H11Cl2NO3 |
| CAS# | 69002-84-2 |
| Purity | >97% |
| Inchi | InChI=1S/C14H11Cl2NO3/c15-10-2-1-3-11(16)14(10)17-12-5-4-9(18)6-8(12)7-13(19)20/h1-6,17-18H,7H2,(H,19,20) |
| Inchi Key | VNQURRWYKFZKJZ-UHFFFAOYSA-N |
| SMILES | OC1=CC=C(NC2=C(Cl)C=CC=C2Cl)C(CC(O)=O)=C1 |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/cdx-h0053/5-hydroxydiclofenac.html |
