6BIO
Potent, reversible and ATP-competitive glycogen synthase kinase-3alpha/beta (GSK-3alpha/beta) inhibitor. JAK/STAT3 signaling inhibitor. Phosphoinositide-dependent kinase 1 (PDK1) inhibitor. Anticancer compound. Potent antiproliferative agent. Suppresses metastasis. Apoptosis inducer. Sustains pluripotency and self-renewal of human and mouse embryonic stem cells (ESCs) by activation of the Wnt signaling pathway. Anti-leishmanial (IC50 = 0.150µM). Proto-oncogene tyrosine-protein kinase receptor RET inhibitor (IC50=0.51µM). Inhibits HIV-1 transcription and protects against Tat induced neurotoxicity.
| Catalog Number | AG-MR-C0019-M050 |
| Alternative Name(s) | BIO; 6-Bromoindirubin-3'-oxime |
| Research Area | Biochemicals, Cancer |
| Molecular Formula | C16H10BrN3O2 |
| CAS# | 667463-62-9 |
| Purity | >99% |
| Inchi | InChI=1S/C16H10BrN3O2/c17-8-5-6-9-12(7-8)19-16(21)13(9)15-14(20-22)10-3-1-2-4-11(10)18-15/h1-7,18,22H,(H,19,21)/b15-13-,20-14+ |
| Inchi Key | DDLZLOKCJHBUHD-WAVHTBQISA-N |
| SMILES | ON=C1C(NC2=CC=CC=C12)=C1C(=O)NC2=C1C=CC(Br)=C2 |
| Size | 50 mg |
| Supplier Page | http://www.adipogen.com/mr-c0019/6bio.html |