(3S,6R)-Lateritin
N-methylated peptide that is structurally equivalent to a monomer of beauvericin (Prod. No. AG-CN2-0043). Acyl-CoA:cholesterol acyltransferase (ACAT) inhibitor. Platelet aggregation inhibitor. Antimicrobial. Note: The (3R,6R)-stereoisomer was shown to have anti-cancer and apoptosis inducing activity.
| Catalog Number | AG-CN2-0042-M001 |
| Alternative Name(s) | (3S,6R)-Bassiatin; Antibiotic PI290 |
| Research Area | Antibiotic, Apoptosis, Cancer, Immunology, Natural Products |
| Molecular Formula | C15H19NO3 |
| CAS# | 65454-13-9 |
| Purity | >97% |
| Inchi | InChI=1S/C15H19NO3/c1-10(2)13-14(17)16(3)12(15(18)19-13)9-11-7-5-4-6-8-11/h4-8,10,12-13H,9H2,1-3H3/t12-,13+/m0/s1 |
| Inchi Key | YOKBTBNVNCFOBF-QWHCGFSZSA-N |
| SMILES | CC(C)[C@H]1OC(=O)[C@H](CC2=CC=CC=C2)N(C)C1=O |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0042/-3s-6r-lateritin.html |
