Oxaliplatin
Potent platinum-based antineoplastic agent with wide spectrum anticancer activity. Anticancer compound. Forms inter- and intrastrand DNA adducts/crosslinks, consequently blocking DNA replication and transcription and inducing cell death. Shows antitumor activity in cisplatin resistant cell lines. Shows better biochemical, pharmacological and cytotoxic properties than cisplatin (Prod. No. AG-CR1-3590) and carboplatin (Prod. No. AG-CR1-3591). Apoptosis inducer. Targets other proteins and enzymes. Anticancer activity and antitumor specificity depends on selective uptake through human organic cation transporters 1 (OCT1) and OCT2. Neurotoxic profile depends on organic cation transporter 2 (OCT2) uptake.
| Catalog Number | AG-CR1-3592-M100 |
| Alternative Name(s) | Diaminocyclohexane oxalatoplatinum; 1-OHP; ACT 078; RP 54780; NSC 266046 |
| Research Area | Apoptosis, Biochemicals, Cancer, Cell Death |
| Molecular Formula | C8H14N2O4Pt |
| CAS# | 61825-94-3 |
| Purity | >98% |
| Inchi | InChI=1S/C6H14N2.C2H2O4.Pt/c7-5-3-1-2-4-6(5)8;3-1(4)2(5)6;/h5-6H,1-4,7-8H2;(H,3,4)(H,5,6);/q;;+2/p-2/t5-,6-;;/m0./s1 |
| Inchi Key | ZROHGHOFXNOHSO-USPAICOZSA-L |
| SMILES | O=C1O[Pt]2(N[C@H]3CCCC[C@@H]3N2)OC1=O |
| Size | 100 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3592/oxaliplatin.html |
