Heptelidic acid
Antibiotic. Potent selective glyceraldehyde 3-phosphate dehydrogenase (GAPDH) inhibitor. Binds to the essential Cys149 residue in the catalytic site of GADPH. Anticancer compound. Selectively kills high-glycolytic cancer cells through glucose-dependent active ATP deprivation. Antimalarial. Apoptosis inhibitor. DNA fragmentation and caspase-3 activation inhibitor. Selective and competitive inhibitor of mammalian DNA polymerases beta, lambda and terminal deoxynucleotidyl transferase (TdT) in family X of pols.
| Catalog Number | AG-CN2-0118-C250 |
| Alternative Name(s) | Koningic acid; Avocettin; FO-4443; BRN 5091359 |
| Research Area | Antibiotic, Apoptosis, Cancer, Cell Death, Inflammation, Natural Products |
| Molecular Formula | C15H20O5 |
| CAS# | 57710-57-3 (74310-84-2 deleted) |
| Purity | >95% |
| Inchi | InChI=1S/C15H20O5/c1-8(2)10-3-4-15(7-20-15)12-11(10)5-9(13(16)17)6-19-14(12)18/h5,8,10-12H,3-4,6-7H2,1-2H3,(H,16,17)/t10-,11-,12-,15-/m1/s1 |
| Inchi Key | JESMSCGUTIEROV-RTWAVKEYSA-N |
| SMILES | [H][C@@]12C=C(COC(=O)[C@@]1([H])[C@@]1(CO1)CC[C@H]2C(C)C)C(O)=O |
| Size | 250 µg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0118/heptelidic-acid.html |
