L-(-)-Camphoric acid
Chirality inducing agent. Useful tool as resolving agent to separate the isomers and purify racemic mixtures (e.g. DL-lysine) by fractionally crystallizing the product to obtain the pure isomer (e.g. D-lysine). Can also be used as building block.
| Catalog Number | AG-CN2-0456-M500 |
| Alternative Name(s) | (1S,3R)-Camphoric acid; (1S,3R)-1,2,2-Trimethyl-1,3-cyclo-pentanedicarboxylic acid |
| Research Area | Biochemicals |
| Molecular Formula | C10H16O4 |
| CAS# | 560-09-8 |
| Purity | >98% |
| Inchi | InChI=1S/C10H16O4/c1-9(2)6(7(11)12)4-5-10(9,3)8(13)14/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14)/t6-,10+/m0/s1 |
| Inchi Key | LSPHULWDVZXLIL-QUBYGPBYSA-N |
| SMILES | CC1(C)C(CC[C@]1(C)C(O)=O)C(O)=O |
| Size | 500 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0456/l-camphoric-acid.html |