(-)-Camphoric acid
Chirality inducing agent. Useful tool as resolving agent to separate the isomers and purify racemic mixtures (e.g. DL-lysine) by fractionally crystallizing the product to obtain the pure isomer (e.g. D-lysine). Can also be used as building block.
| Catalog Number | CDX-C0144-G010 |
| Alternative Name(s) | (1S,3R)-1,2,2-Trimethyl-1,3-cyclopentanedicarboxylic acid |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C10H16O4 |
| CAS# | 560-09-8 |
| Purity | >99% |
| Inchi | InChI=1S/C10H16O4/c1-9(2)6(7(11)12)4-5-10(9,3)8(13)14/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14) |
| Inchi Key | LSPHULWDVZXLIL-UHFFFAOYSA-N |
| SMILES | CC1(C)[C@@H](CC[C@]1(C)C(O)=O)C(O)=O |
| Size | 10 g |
| Supplier Page | http://www.adipogen.com/cdx-c0144/-camphoric-acid.html |
