MnTBAP chloride
Cell permeable superoxide dismutase (SOD) mimetic. Potent inhibitor of peroxynitrite-induced oxidative reactions (peroxynitrite scavenger), but not a scavenger of nitric oxide (NO). Neuronal apoptosis inhibitor. Protects T cells from superoxide generation, caspase-dependent DNA loss and cell death. Lipopolysaccharide-induced TNF-alpha production inhibitor, by prevention of intracellular ROS generation and subsequent inactivation of p38 MAPK and SAPK/JNK. .
| Catalog Number | AG-CR1-0133-M010 |
| Alternative Name(s) | Manganese (III) tetrakis (4-benzoic acid)porphyrin chloride |
| Research Area | Biochemicals, Inflammation, Neurodegenerative Disease |
| Molecular Formula | C48H28MnN4O8Cl |
| CAS# | 55266-18-7 |
| Purity | >97% |
| Inchi | InChI=1S/C48H30N4O8.ClH.Mn/c53-45(54)29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(12-4-26)46(55)56)37-21-23-39(51-37)44(28-7-15-32(16-8-28)48(59)60)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(14-6-27)47(57)58;;/h1-24,33,38H,(H,53,54)(H,55,56)(H,57,58)(H,59,60);1H;/q-4;;+7/p-1/b41-34-,42-35-,43-36-,44-40-;; |
| Inchi Key | APHAGHGOUIMDLD-SAHKUQKESA-M |
| SMILES | [Cl-].OC(=O)C1=CC=C(C=C1)C1=C2C=CC3=C(C4C=CC5=C(C6=CC=C7N6[Mn+3](N6C1C=CC6=C7C1=CC=C(C=C1)C(O)=O)(N45)N23)C1=CC=C(C=C1)C(O)=O)C1=CC=C(C=C1)C(O)=O |
| Size | 10 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-0133/mntbap-chloride.html |
