3,3′-Dipropylthiacarbocyanine iodide
Carbocyanine dyes, particularly thiacyanines such as DiSC3(3) can inhibit respiration and may therefore be relatively cytotoxic. 3,3′-dipropyl-thiadicarbocyanine iodide is sensitive to membrane potential, fluorescence response to depolarization depends on the staining concentration and detection method. Selected applications are: -Calcium channels and other ion transport systems -Mitochondrial activity -Neurons and brain tissue -Membrane potential in intact yeast cells

Catalog Number | CDX-D0007-M250 |
Alternative Name(s) | DiSC(3)(3) |
Research Area | Biochemicals, Immunology |
Molecular Formula | C₂₃H₂₅IN₂S₂ |
CAS# | 53336-12-2 |
Purity | >98% |
Inchi | InChI=1S/C23H25N2S2.HI/c1-3-16-24-18-10-5-7-12-20(18)26-22(24)14-9-15-23-25(17-4-2)19-11-6-8-13-21(19)27-23;/h5-15H,3-4,16-17H2,1-2H3;1H/q+1;/p-1 |
Inchi Key | JGTCEHAVVINOPG-UHFFFAOYSA-M |
SMILES | [I-].CCCN1C(SC2=C1C=CC=C2)=C/C=C/C1=[N+](CCC)C2=C(S1)C=CC=C2 |
Size | 250 mg |
Supplier Page | http://www.adipogen.com/cdx-d0007/3-3-dipropylthiacarbocyanine-iodide.html |