3,8-Diamino-6-phenylphenanthridine
Phenyl-phenanthridine dye with a large pi-conjugated structure and strong luminescence. Used in the synthesis of rigid polyamides and fluorescent probes. DNA intercalator. Used as a chromatographic affinity ligand for the specific separation and purification of supercoiled plasmid DNA (pDNA). It has been investigated for its anti-tumor and anti-viral properties.
![](https://smallmolecules.com/sm/wp-content/uploads/2017/04/cdx-d0436.png)
Catalog Number | CDX-D0436-G001 |
Alternative Name(s) | 6-Phenylphenathridine-3,8-diamine; 3,8-DAPP; DAPP |
Research Area | Biochemicals, Cancer, Immunology |
Molecular Formula | C19H15N3 |
CAS# | 52009-64-0 |
Purity | >98% |
Inchi | InChI=1S/C19H15N3/c20-13-6-8-15-16-9-7-14(21)11-18(16)22-19(17(15)10-13)12-4-2-1-3-5-12/h1-11H,20-21H2 |
Inchi Key | CPNAVTYCORRLMH-UHFFFAOYSA-N |
SMILES | NC1=CC2=C(C(C=CC(N)=C3)=C3N=C2C4=CC=CC=C4)C=C1 |
Size | 1 g |
Supplier Page | http://www.adipogen.com/cdx-d0436/3-8-diamino-6-phenylphenanthridine.html |