3-Methyladenine
Potent cell permeable and selective inhibitor of phosphatidyl-inositol 3-kinase (PI3K). Blocks class I, class II and class III PI3Ks, including some downstream targets. Blocks class I PI3K persistently and class III PI3K transiently. Induces autophagy under nutrient-rich conditions and inhibits starvation-induced autophagy due to differential effects on class I versus class III PI3 kinase. Shows some limited Vps34 preference in vitro compared to PtdIns3Kgamma. However, it is typically employed in cellular studies at a concentration of 10 mM, which can inhibit all PtdIns3Ks. Can target other kinases and affect other cellular processes, such as glycogen metabolism, lysosomal acidification, endocytosis and mitochondrial permeability transition. Anticancer compound. Neuroprotective. PKA-activation dependent lipolytic agent. Enhances ATGL-dependent hydrolysis of triacylglycerols.

Catalog Number | AG-CR1-3597-M025 |
Alternative Name(s) | 3-MA; 3MeA; 6-Amino-3-methylpurine; NSC 66389 |
Research Area | Apoptosis, Autophagy, Cancer, Inflammation, Metabolism, Neurobiology, Neurodegenerative Disease |
Molecular Formula | C6H7N5 |
CAS# | 5142-23-4 |
Purity | >98% |
Inchi | InChI=1S/C6H7N5/c1-11-3-10-5(7)4-6(11)9-2-8-4/h2-3H,7H2,1H3 |
Inchi Key | FSASIHFSFGAIJM-UHFFFAOYSA-N |
SMILES | CN1C=NC(N)=C2N=CN=C12 |
Size | 25 mg |
Supplier Page | http://www.adipogen.com/ag-cr1-3597/3-methyladenine.html |