WY-14643
Potent peroxisome proliferator-activated receptor (PPARalpha) activator. Activates also PPARgamma but not PPARdelta. Potent anti-hypercholesterolemic agent. Hypolipidemic compound. Lipogenesis inducer. Tumor promoter. Causes increased cell proliferation and decreased apoptosis. Anti-inflammatory. Inhibits NF-kappaB transcriptional activity and decreases the inflammatory response by reducing the production of inflammatory cytokines (TNF-alpha, IL1beta). Reduces oxidative stress. Increases fatty acid oxidation. Directly affects insulin signaling. Increases glucose uptake. Reviews.
| Catalog Number | AG-CR1-3566-M010 |
| Alternative Name(s) | Pirinixic acid; NSC 310038; BRN 0759945; ((4-Chloro-6-((2,3-dimethylphenyl)amino)-2-pyrimidinyl)thio) acetic acid |
| Research Area | Biochemicals, Immunology, Inflammation, Metabolism |
| Molecular Formula | C14H14ClN3O2S |
| CAS# | 50892-23-4 |
| Purity | >98% |
| Inchi | InChI=1S/C20H29NO5S/c1-13-5-3-4-6-14(2)9-18(22)25-16-10-15(8-7-13)26-20(24,11-16)17-12-27-19(23)21-17/h3,5,9,13,15-17,24H,4,6-8,10-12H2,1-2H3,(H,21,23)/b5-3-,14-9-/t13-,15-,16-,17-,20-/m1/s1 |
| Inchi Key | NSHPHXHGRHSMIK-WAXGXQFOSA-N |
| SMILES | CC1=CC=CC(NC2=NC(SCC(O)=O)=NC(Cl)=C2)=C1C |
| Size | 10 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3566/wy-14643.html |
