(S,S)-(-)-1,4-Dimethoxy-2,3-butanediol
Building block for synthesis. For chiral auxiliary modification of LAH. Condensation of ester enolates and chiral imines to beta-lactams. Auxiliary, reactions of its acetal. Determination of the enantiomeric purity of ketones by acetal formation and 13C-NMR.
| Catalog Number | CDX-D0434-G005 |
| Alternative Name(s) | 1,4-Di-O-methyl-L-threitol |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C6H14O4 |
| CAS# | 50622-10-1 |
| Purity | >99% |
| Inchi | InChI=1S/C6H14O4/c1-9-3-5(7)6(8)4-10-2/h5-8H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| Inchi Key | QPXJVYUZWDGUBO-WDSKDSINSA-N |
| SMILES | COC[C@H](O)[C@@H](O)COC |
| Size | 5 g |
| Supplier Page | http://www.adipogen.com/cdx-d0434/-s-s-1-4-dimethoxy-2-3-butanediol.html |
