Ophiobolin A
Cell permeable, irreversible calmodulin antagonist. Acts by covalently binding to a lysine-rich inhibitory site. Inhibits by blocking the activation of the Ca2+/calmodulin-dependent phosphodiesterase. Herbicidal mycotoxin. Phytotoxic, antifungal, antibacterial and nematocidal compound. Anticancer compound. Shown to induce paraptosis-like cell death. Shown to inhibit P-glycoprotein-mediated transport.
| Catalog Number | AG-CN2-0431-C100 |
| Alternative Name(s) | Cochliobolin A; Ophiobalin; NSC 114340 |
| Research Area | Apoptosis, Biochemicals, Cancer, Cell Death, Immunology, Natural Products |
| Molecular Formula | C25H36O4 |
| CAS# | 4611-05-6 |
| Purity | >95% |
| Inchi | InChI=1S/C25H36O4/c1-15(2)10-18-11-16(3)25(29-18)9-8-23(4)12-19-22(20(27)13-24(19,5)28)17(14-26)6-7-21(23)25/h6,10,14,16,18-19,21-22,28H,7-9,11-13H2,1-5H3/b17-6-/t16-,18-,19-,21+,22+,23+,24+,25-/m0/s1 |
| Inchi Key | MWYYLZRWWNBROW-BDZRSQQBSA-N |
| SMILES | [H]C(=O)C1=C[C@]2([H])[C@](C)(CC[C@@]22O[C@H](C[C@@H]2C)C=C(C)C)C[C@@]2([H])[C@]1([H])C(=O)C[C@@]2(C)O |
| Size | 100 µg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0431/ophiobolin-a.html |
