Genistein
Cell-permeable, reversible, substrate competitive tyrosine kinase inhibitor (including EGFR phosphorylation), implicated in almost all cell growth and proliferation signal cascades. Inhibitor of mammalian DNA topoisomerase II. Anticancer agent, inducing cell cycle arrest and apoptosis. Antiangiogenic agent, down-regulates the transcription of genes involved in controlling angiogenesis. Binds estrogen receptor beta. Can increase the rate of growth of some ER expressing breast cancers. Potent alpha-glucosidase inhibitor. Anthelmintic. Anti-diabetic. Activates nuclear receptors, oestrogen receptors and peroxisome proliferator-activated receptors (all PPAR isoforms) and it inhibits various enzyme activities. Inhibitor of GLUT4-mediated glucose uptake in 3T3-L1 adipocytes. Stimulator of autophagy vacuolization. Antioxidant. TRAIL sensitizer. Acts as an agonist at the GPR30 receptor. MALT1 inhibitor DNA methyltransferase inhibitor. Genistein exhibits synergistic antibacterial effects on MRSA.
| Catalog Number | AG-CN2-0427-M250 |
| Alternative Name(s) | NSC 36586; Baichanin A; Differenol A; 4',5,7-Trihydroxyisoflavone; 5,7-Dihydroxy-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
| Research Area | Antibiotic, Cancer, Immunology, Inflammation, Metabolism, Natural Products, Neurobiology, Neurodegenerative Disease |
| Molecular Formula | C15H10O5 |
| CAS# | 446-72-0 |
| Purity | >99% |
| Inchi | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,16-18H |
| Inchi Key | TZBJGXHYKVUXJN-UHFFFAOYSA-N |
| SMILES | OC1=CC=C(C=C1)C1=COC2=CC(O)=CC(O)=C2C1=O |
| Size | 250 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0427/genistein.html |
