Salinosporamide A
Potent, irreversible inhibitor of all the 3 proteolytic activities of the mammalian 20S proteasome. beta5 subunit: chymotrypsin-like (EC50 = 3.5nM) beta2 subunit: trypsin-like (EC50 = 28nM) beta1 subunit: caspase-like or peptidyl-glutamyl peptide-hydrolyzing (PGPH) (EC50 = 430nM) Potent anticancer compound. Triggers apoptosis, with distinct proteasome activity and mechanism of action compared to bortezomib (Velcade) (Prod. No. AG-CR1-3602). Most potent suppressor of NF-kappaB activation, compared with bortezomib, MG-132 (Prod. No. AG-CP3-0011), N-acetyl-leucyl-leucyl-norleucinal (ALLN) and lactacystin (Prod. No. AG-CN2-0104). Inhibitor of TNF-alpha, IL-1, IL-6, ICAM-1 and VEGF synthesis. Displays a longer inhibition duration than bortezomib. Potent antileukemic activity against bortezomib-resistant leukemia cells.
| Catalog Number | AG-CN2-0444-C100 |
| Alternative Name(s) | SalA; Marizomib; NPI-0052 |
| Research Area | Apoptosis, Autophagy, Cancer, Cell Death, Natural Products, Neurodegenerative Disease |
| Molecular Formula | C15H20ClNO4 |
| CAS# | 437742-34-2 |
| Purity | >95% |
| Inchi | InChI=1S/C15H20ClNO4/c1-14-10(7-8-16)12(19)17-15(14,13(20)21-14)11(18)9-5-3-2-4-6-9/h3,5,9-11,18H,2,4,6-8H2,1H3,(H,17,19)/t9-,10+,11+,14+,15+/m1/s1 |
| Inchi Key | NGWSFRIPKNWYAO-SHTIJGAHSA-N |
| SMILES | [H][C@](O)([C@@]1([H])CCCC=C1)[C@@]12NC(=O)[C@H](CCCl)[C@]1(C)OC2=O |
| Size | 100 µg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0444/salinosporamide-a.html |