PD 150,606
Cell permeable and selective calpain-1 and -2 inhibitor. Interacts with calcium-binding domain of calpain. Neuroprotective. Ca2+-permeable AMPA receptor inhibitor. Apoptosis inhibitor Autophagy activator by preventing cleavage of ATG5
| Catalog Number | AG-CR1-0066-M005 |
| Alternative Name(s) | 3-(4-Iodophenyl)-2-mercapto-(Z)-2-propenoic acid |
| Research Area | Apoptosis, Autophagy, Biochemicals, Cancer, Cell Death |
| Molecular Formula | C9H7IO2S |
| CAS# | 426821-41-2 |
| Purity | >98% |
| Inchi | InChI=1S/C9H7IO2S/c10-7-3-1-6(2-4-7)5-8(13)9(11)12/h1-5,13H,(H,11,12)/b8-5- |
| Inchi Key | DJCVSFWGKYHMKH-YVMONPNESA-N |
| SMILES | OC(=O)C(S)=CC1=CC=C(I)C=C1 |
| Size | 5 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-0066/pd-150-606.html |