Carboplatin
Potent platinum-based antineoplastic agent. Analog of cisplatin (Prod. No. AG-CR1-3590) with reduced nephrotoxicity and higher stability. Antitumor agent. Forms inter- and intrastrand DNA adducts/crosslinks, consequently blocking DNA replication and transcription and inducing cell death. Interferes with cell division by mitosis. The damaged DNA elicits DNA repair mechanisms, which in turn activate apoptosis when repair is impossible. Apoptosis inducer. Enhances radiation-induced single-strand DNA breakage.
| Catalog Number | AG-CR1-3591-M025 |
| Alternative Name(s) | cis-Diammine(cyclobutane-1,1-dicarboxylate-O,O')platinum(II); NSC201345; NSC241240; JM-8; Paraplatin; Cbdca |
| Research Area | Apoptosis, Biochemicals, Cancer, Cell Death |
| Molecular Formula | C6H12N2O4Pt |
| CAS# | 41575-94-4 |
| Purity | >98% |
| Inchi | InChI=1S/C6H8O4.2H2N.Pt/c7-4(8)6(5(9)10)2-1-3-6;;;/h1-3H2,(H,7,8)(H,9,10);2*1H2;/q;2*-1;+4/p-2 |
| Inchi Key | YAYRGNWWLMLWJE-UHFFFAOYSA-L |
| SMILES | N[Pt]1(N)OC(=O)C2(CCC2)C(=O)O1 |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3591/carboplatin.html |
