Neobavaisoflavone
Antibiotic. Antibacterial and antifungal compound. Displays antibiotic activity against Gram-negative multidrug resistant bacteria. Anticancer compound. DNA polymerase inhibitor. Enhances TRAIL-induced apoptosis via inhibition of metastasis. Anti-inflammatory agent inhibiting IL-6-induced STAT3 activation and phosphorylation. Platelet aggregation inhibitor. Human carboxylesterase 1&2 and UDP-glucuronosyltransferase 1A1 inhibitor, enzymes important in drug metabolism. Antioxidant. Inhibits the production of nitric oxide (NO), reactive oxygen species (ROS) and reactive nitrogen species (RNS). Neuroprotective. Exerts protective effects against H2O2-induced neuronal cell damage. Shows osteogenic acitivty.
| Catalog Number | AG-CN2-0498-M001 |
| Alternative Name(s) | 7-Hydroxy-3-(4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl)-4H-1-benzopyran-4-one; 3'-Prenyldaidzein |
| Research Area | Antibiotic, Cancer, Inflammation, Natural Products, Neurobiology |
| Molecular Formula | C20H18O4 |
| CAS# | 41060-15-5 |
| Purity | >98% |
| Inchi | InChI=1S/C20H18O4/c1-12(2)3-4-14-9-13(5-8-18(14)22)17-11-24-19-10-15(21)6-7-16(19)20(17)23/h3,5-11,21-22H,4H2,1-2H3 |
| Inchi Key | OBGPEBYHGIUFBN-UHFFFAOYSA-N |
| SMILES | OC1=CC=C(C(C(C2=CC=C(O)C(C/C=C(C)/C)=C2)=CO3)=O)C3=C1 |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0498/neobavaisoflavone.html |
