(+)-Aphidicolin
Phytotoxin. Antibiotic. Antiviral and antineoplastic agent. Antileishmanial agent. Reversible inhibitor of eukaryotic nuclear DNA replication. Useful for cell synchronization. Blocks the cell cycle at G1/S phase. Prolongs the half life of DNA methyltransferase. DNA methylation/demethylation modulator. Specific DNA polymerase alpha and delta inhibitor in eukaryotic cells and in some viruses of animal origin. Acts synergistically with vincristine and doxorubicin. Apoptosis inhibitor/inducer.
| Catalog Number | BVT-0307-M001 |
| Alternative Name(s) | NSC234714; BRN4689958; ICI69653 |
| Research Area | Antibiotic, Apoptosis, Cancer, Immunology, Natural Products |
| Molecular Formula | C20H34O4 |
| CAS# | 38966-21-1 |
| Purity | >98% |
| Inchi | InChI=1S/C20H34O4/c1-17(11-21)15-4-3-13-9-14-10-19(13,7-8-20(14,24)12-22)18(15,2)6-5-16(17)23/h13-16,21-24H,3-12H2,1-2H3/t13-,14+,15-,16+,17-,18-,19-,20-/m0/s1 |
| Inchi Key | NOFOAYPPHIUXJR-APNQCZIXSA-N |
| SMILES | [H][C@]12C[C@@H]3C[C@]1(CC[C@]3(O)CO)[C@@]1(C)CC[C@@H](O)[C@@](C)(CO)[C@]1([H])CC2 |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/bvt-0307/-aphidicolin.html |