JC-1
A dual-emission potential-sensitive probe that can be used to measure mitochondrial membrane potential. JC-1 is a green-fluorescent monomer at low membrane potential. At higher potentials, JC-1 forms red-fluorescent “J-aggregates,” which exhibit broad excitation and very narrow emission spectra. The ratio of red to green fluorescence of JC-1 is dependent only on membrane potential, and not influenced by mitochondrial size, shape, or density.
| Catalog Number | CDX-T0046-M100 |
| Alternative Name(s) | JC-1 jodide |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C25H27Cl4IN4 |
| CAS# | 3520-43-2 |
| Purity | >90% |
| Inchi | InChI=1S/C25H27Cl4N4.HI/c1-5-30-20-12-16(26)17(27)13-21(20)31(6-2)24(30)10-9-11-25-32(7-3)22-14-18(28)19(29)15-23(22)33(25)8-4;/h9-15H,5-8H2,1-4H3;1H/q+1;/p-1 |
| Inchi Key | FYNNIUVBDKICAX-UHFFFAOYSA-M |
| SMILES | [I-].CCN1C(=CC=CC2=[N+](CC)C3=C(C=C(Cl)C(Cl)=C3)N2CC)N(CC)C2=C1C=C(Cl)C(Cl)=C2 |
| Size | 100 mg |
| Supplier Page | http://www.adipogen.com/cdx-t0046/jc-1.html |