Incensol acetate
Component of the frankincense essential oil. Activator of transient receptor potential vanilloid 3 (TRPV3), a heat-sensitive ion channel involved in skin heat sensitivity, thermoregulation and neurological activities. Less powerful TRPV3 agonist than incensol (Prod. No. AG-CN2-0482). Shows in vivo neuroprotective properties. Causes anxiolytic-like and antidepressive-like behavioral effects in wild-type (WT) mice. Anti-inflammatory agent. Shown to have COX-1 and COX-2 inhibitory activity and cytotoxic activity against selected cancer cell lines.
| Catalog Number | AG-CN2-0484-M001 |
| Alternative Name(s) | (+)-Incensol acetate; (+)-Incensole acetate; (1R,2S,5E,9E,12S)-(9Cl)-1,5,9-Trimethyl-12-(1-methylethyl)-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-ol acetate |
| Research Area | Biochemicals, Inflammation, Neurobiology |
| Molecular Formula | C22H36O3 |
| CAS# | 34701-53-6 |
| Purity | >95% |
| Inchi | InChI=1S/C22H36O3/c1-16(2)22-13-12-18(4)9-7-8-17(3)10-11-20(24-19(5)23)21(6,25-22)14-15-22/h8,12,16,20H,7,9-11,13-15H2,1-6H3/b17-8+,18-12+/t20-,21+,22+/m0/s1 |
| Inchi Key | HVBACKJYWZTKCA-XSLBTUIJSA-N |
| SMILES | C/C1=CCC/C(C)=C/C[C@]2(C(C)C)CC[C@@](C)(O2)[C@@H](OC(C)=O)CC1 |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0484/incensol-acetate.html |
