DAR-4M Solution
Photo-stable fluorescent probe (Ex: ~560nm; Em: 575nm) for the detection of nitric oxide (NO) in presence of oxygen, resulting in a triazolo-rhodamine analog (DAR-4M T) that exhibits about 840-fold greater fluorescence quantum efficiency. Suitable probe for monitoring RNS production, but not NO alone. Stable in a pH range of 4-12. Detection limit ~10nM.
| Catalog Number | CDX-D0506-M001 |
| Alternative Name(s) | Diaminorhodamine-4M; 3,6-Bis(dimethylamino)-9-[3-amino-4-(N-methylamino)-2-carboxyphenyl]xanthylium |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C25H26N4O3 |
| CAS# | 339527-79-6 |
| Purity | >98% |
| Inchi | InChI=1S/C25H26N4O3/c1-27-19-11-10-18(23(24(19)26)25(30)31)22-16-8-6-14(28(2)3)12-20(16)32-21-13-15(29(4)5)7-9-17(21)22/h6-13,27H,26H2,1-5H3 |
| Inchi Key | LNDSYTUQQCXPAM-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C(C([O-])=O)=C1N)C1=C2C=CC(=CC2=[O+]C2=C1C=CC(=C2)N(C)C)N(C)C |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/cdx-d0506/dar-4m-solution.html |
