ZnAF-2 Solution
A membrane-impermeable ethylenediaminofluoresceinyl compound that acts as a high-affinity Zn2+-specific fluorescent probe (Kd = 2.7 nM). It shows low basal fluorescence and the fluorescence intensity increases ~51-fold upon stoichiometric (1:1) binding to Zn2+. Exhibits little affinity towards Ca2+, Mg2+, Na+, or K+. Spectral data: lambdaex 492nm; lambdaem 515nm in PBS.
| Catalog Number | CDX-Z0506-M001 |
| Alternative Name(s) | 6-{2-[Bis(2-pyridylmethyl)amino]ethylamino}fluorescein |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C34H28N4O5 |
| CAS# | 321859-11-4 |
| Purity | >95% |
| Inchi | InChI=1S/C34H28N4O5/c39-25-8-11-28-31(18-25)42-32-19-26(40)9-12-29(32)34(28)30-17-22(7-10-27(30)33(41)43-34)37-15-16-38(20-23-5-1-3-13-35-23)21-24-6-2-4-14-36-24/h1-14,17-19,37,39-40H,15-16,20-21H2 |
| Inchi Key | IJNFGJFEJQCIIT-UHFFFAOYSA-N |
| SMILES | OC1=CC2=C(C=C1)C1(OC(=O)C3=C1C=C(NCCN(CC1=CC=CC=N1)CC1=NC=CC=C1)C=C3)C1=CC=C(O)C=C1O2 |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/cdx-z0506/znaf-2-solution.html |
