5,7-Dihydroxytryptamine hydrobromide
Autofluorescent serotonin derivative. Serotonergic neurotoxin, depleting serotonin and norepinephrine. Can be used for the identification of living serotonergic neurons even in the presence of dopaminergic neurons. Its selectively uptaken into 5-hydroxytryptamine neurons. It’s oxidation products are often more potent then the parent product.
| Catalog Number | CDX-H0026-M025 |
| Alternative Name(s) | 5,7-DHT; 3-(2-Aminoethyl)-1H-indole-5,7-diol |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C10H12N2O2 . HBr |
| CAS# | 31363-74-3 (free base) |
| Purity | >95% |
| Inchi | InChI=1S/C10H12N2O2.BrH/c11-2-1-6-5-12-10-8(6)3-7(13)4-9(10)14;/h3-5,12-14H,1-2,11H2;1H |
| Inchi Key | KVRZGCBQKAJSBN-UHFFFAOYSA-N |
| SMILES | [Br-].[NH3+]CCC1=CNC2=C(O)C=C(O)C=C12 |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/cdx-h0026/5-7-dihydroxytryptamine-hydrobromide.html |