Oxyresveratrol
Naturallly occuring analog of resveratrol. Potent antioxidant and free-radical scavenger. Shown to have neuroprotective activity against cerebral ischemia and against traumatic injury. Apoptosis inhibitor in transient cerebral ischemia. Inhibits viral DNA replication and late viral protein synthesis of African Swine fever virus. Has depigmenting effects by effectively inhibiting tyrosinase activity, which catalyzes the rate-limiting step in synthesizing melanin pigments. Has anti-inflammatory properties based on inhibition of iNOS expression through down-regulation of NF-kB binding activity and significant inhibition of COX-2 activity. Antihyperlipidemic agent.
| Catalog Number | CDX-O0035-M100 |
| Alternative Name(s) | trans-2',3,4',5-Tetramethoxystilbene |
| Research Area | Biochemicals, Inflammation |
| Molecular Formula | C14H12O4 |
| CAS# | 29700-22-9 |
| Purity | >98% |
| Inchi | InChI=1S/C14H12O4/c15-11-4-3-10(14(18)8-11)2-1-9-5-12(16)7-13(17)6-9/h1-8,15-18H/b2-1- |
| Inchi Key | PDHAOJSHSJQANO-UPHRSURJSA-N |
| SMILES | OC1=CC(O)=C(C=CC2=CC(O)=CC(O)=C2)C=C1 |
| Size | 100 mg |
| Supplier Page | http://www.adipogen.com/cdx-o0035/oxyresveratrol.html |
