NBD-F
NBD fluoride is similar to NBD chloride except that the former is much more reactive toward amines. Both reagents are nonfluorescent until they react with primary or secondary amines to produce a fluorescent product. NBD chloride and NBD fluoride have been extensively used as derivatizing reagents for chromatography analysis of amino acids and low molecular weight amines.
| Catalog Number | CDX-F0017-M025 |
| Alternative Name(s) | 4-Fluoro-7-nitrobenzofurazan |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C6H2FN3O3 |
| CAS# | 29270-56-2 |
| Purity | >98% |
| Inchi | InChI=1S/C6H2FN3O3/c7-3-1-2-4(10(11)12)6-5(3)8-13-9-6/h1-2H |
| Inchi Key | PGZIDERTDJHJFY-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)C1=CC=C(F)C2=NON=C12 |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/cdx-f0017/nbd-f.html |
