Resorufin-isobutyrate
Cell permeable resorufin derivative used as a fluorogenic indicator for cell viability. Resorufin was selected as the fluorophore because it fluoresces at a longer wavelength and is amenable to modification at the hydroxyl group which is essential for its fluorescence. Incubation with esterase at pH 8.0 results in a 80-90 nm shift of emission max. (Ex/Em: 500/~593nm in 0.1 M Tris pH 8.0 (after cleavage by esterase)). This cell viability indicator is 2 times more sensitive than calcein-AM.
| Catalog Number | CDX-I0005-M005 |
| Alternative Name(s) | 7-(Isobutyloxycarbonyloxy)-3H-phenoxazin-3-one |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C17H15NO5 |
| CAS# | 251292-24-7 |
| Purity | >97% |
| Inchi | InChI=1S/C17H15NO5/c1-10(2)9-21-17(20)22-12-4-6-14-16(8-12)23-15-7-11(19)3-5-13(15)18-14/h3-8,10H,9H2,1-2H3 |
| Inchi Key | RVDFSVVDUVHHKE-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)OC1=CC2=C(C=C1)N=C1C=CC(=O)C=C1O2 |
| Size | 5 mg |
| Supplier Page | http://www.adipogen.com/cdx-i0005/resorufin-isobutyrat.html |
