Hoechst 33258
Useful for staining DNA, chromosomes and nuclei. Binds to the minor groove of DNA at AT-rich sequences. This dye is commonly used for determining the DNA content of viable cells without detergent treatment or fixation and for fluorescence microscopy or flow cytometry.
| Catalog Number | CDX-B0029-G005 |
| Alternative Name(s) | 4-[5-(4-Methyl-1-piperazinyl)-1H,1'H-2,5'-bibenzimidazol-2'-yl]phenol trihydrochloride |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C25H24N6O . 3HCl |
| CAS# | 23491-45-4 |
| Purity | >98% |
| Inchi | InChI=1S/C25H24N6O/c1-30-10-12-31(13-11-30)18-5-9-21-23(15-18)29-25(27-21)17-4-8-20-22(14-17)28-24(26-20)16-2-6-19(32)7-3-16/h2-9,14-15,32H,10-13H2,1H3,(H,26,28)(H,27,29) |
| Inchi Key | INAAIJLSXJJHOZ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C1=CC=C2NC(=NC2=C1)C1=CC=C2NC(=NC2=C1)C1=CC=C(O)C=C1 |
| Size | 5 g |
| Supplier Page | http://www.adipogen.com/cdx-b0029/hoechst-33258.html |
