6,8-Difluoro-7-hydroxy-2-oxo-2H-1-benzopyran-3-carboxylic acid
Fluorinated fluorescent dye. Increased resistance to photobleaching and higher quantum yields makes it a superior fluorescent dye. Pacific Blue dyes yield conjugates that are strongly fluorescent, even at neutral pH. Spectral data: Extinction 403nm/Emmission 455nm. The amine-reactive succinimidyl ester derivative can be used to create bright blue-fluorescent bioconjugates with excitation/emission maxima ~410/455 nm that are excitable by the 405 nm spectral line of the blue diode (violet) laser.
| Catalog Number | CDX-D0079-M010 |
| Alternative Name(s) | Pacific Blue |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C10H4F2O5 |
| CAS# | 215868-31-8 |
| Purity | >97% |
| Inchi | InChI=1S/C10H4F2O5/c11-5-2-3-1-4(9(14)15)10(16)17-8(3)6(12)7(5)13/h1-2,13H,(H,14,15) |
| Inchi Key | VYNDHICBIRRPFP-UHFFFAOYSA-N |
| SMILES | OC(=O)C1=CC2=CC(F)=C(O)C(F)=C2OC1=O |
| Size | 10 mg |
| Supplier Page | http://www.adipogen.com/cdx-d0079/6-8-difluoro-7-hydroxy-2-oxo-2h-1-benzopyran-3-carboxylic-acid.html |
