PD 184,352
MEK (MAPKK) inhibitor. Potent and selective MAPK (ERK kinase 1; MEK1) activation inhibitor (IC50 = 300 nM in vitro, IC50 = 2 nM in vivo). Suppresses activation of MAPK but does not block its activity. Antiproliferative. Causes cell-cycle arrest in G1 phase. Tumor suppressor. Apoptosis inducer.
| Catalog Number | AG-CR1-0029-M001 |
| Alternative Name(s) | 2-(2-Chloro-4-iodo-phenylamino)-N-cyclopropylmethoxy-3,4-difluorobenzamide; CI-1040 |
| Research Area | Apoptosis, Biochemicals, Cancer, Cell Death |
| Molecular Formula | C17H14ClF2IN2O2 |
| CAS# | 212631-79-3 |
| Purity | >95% |
| Inchi | InChI=1S/C17H14ClF2IN2O2/c18-12-7-10(21)3-6-14(12)22-16-11(4-5-13(19)15(16)20)17(24)23-25-8-9-1-2-9/h3-7,9,22H,1-2,8H2,(H,23,24) |
| Inchi Key | GFMMXOIFOQCCGU-UHFFFAOYSA-N |
| SMILES | FC1=C(F)C(NC2=CC=C(I)C=C2Cl)=C(C=C1)C(=O)NOCC1CC1 |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-0029/pd-184-352.html |
