DAF-2
DAF-2 is highly sensitive reagent for NO detection and determination of nitric oxide synthase activity. DAF-2, however, remains essentially nonfluorescent until it reacts with the nitrosonium cation (produced by spontaneous oxidation of nitric oxide) to form a fluorescent heterocycle, which becomes trapped in the cell’s cytoplasm. This sensitive fluorescent probe has been used to identify individual nitric oxide-producing neurons in brain slices, in mitochondria and in living plant cells. Spectral data: lambdaex 505nm; lambdaem 518nm in 0.1M Tris pH8.0.
| Catalog Number | CDX-D0084-M005 |
| Alternative Name(s) | 4,5-Diaminofluorescein |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C20H14N2O5 |
| CAS# | 205391-01-1 |
| Purity | >95% |
| Inchi | InChI=1S/C20H14N2O5/c21-15-7-11-14(8-16(15)22)20(27-19(11)25)12-3-1-9(23)5-17(12)26-18-6-10(24)2-4-13(18)20/h1-8,23-24H,21-22H2 |
| Inchi Key | LTYUPYUWXRTNFQ-UHFFFAOYSA-N |
| SMILES | NC1=CC2=C(C=C1N)C1(OC2=O)C2=CC=C(O)C=C2OC2=C1C=CC(O)=C2 |
| Size | 5 mg |
| Supplier Page | http://www.adipogen.com/cdx-d0084/daf-2.html |
