Makisterone A
A member of the ecdysteroid family. Ecdysone receptor (EcR) agonist. Induces the expression of genes coding for proteins that the larva requires, and it causes chromosome puffs (sites of high expression) to form in polytene chromosomes. Plays a role in insect development, cell proliferaton, growth and apoptosis by controlling gene expression involved in moulting and metamorphosis. It acts through a heterodimeric receptor comprising the ecdysone receptor and the ultraspiracle proteins (USP). Appears in plants mostly as a protection agent (toxins or antifeedants) against herbivorous insects. Could be used for controlled gene expression in scientific research, agriculture and medicine. Could be used for the development of selective insect growth regulators for use as environmentally benign insecticides.
| Catalog Number | AG-CN2-0073-C250 |
| Alternative Name(s) | 2beta,3beta,14alpha,20R,22R,25-Hexahydroxy-5beta-24R-ergost-7-en-6-one |
| Research Area | Immunology, Natural Products, Pheromone |
| Molecular Formula | C28H46O7 |
| CAS# | 20137-14-8 |
| Purity | >95% |
| Inchi | InChI=1S/C28H46O7/c1-15(24(2,3)33)11-23(32)27(6,34)22-8-10-28(35)17-12-19(29)18-13-20(30)21(31)14-25(18,4)16(17)7-9-26(22,28)5/h12,15-16,18,20-23,30-35H,7-11,13-14H2,1-6H3/t15-,16?,18+,20-,21+,22+,23-,25-,26-,27-,28-/m1/s1 |
| Inchi Key | IJRBORPEVKCEQD-WJUVRXFPSA-N |
| SMILES | [H][C@@]1(CC[C@@]2(O)C3=CC(=O)[C@]4([H])C[C@@H](O)[C@@H](O)C[C@]4(C)C3CC[C@]12C)[C@@](C)(O)[C@H](O)C[C@@H](C)C(C)(C)O |
| Size | 250 µg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0073/makisterone-a.html |
