Streptozotocin
Antibiotic. Diabetogenic. Diabetes inducer. Induces diabetes mellitus in animal models through its toxic effects on pancreatic beta-cells. Mutagenic. Potent alkylating agent. Potent DNA methylating agent. Nitric oxide (NO) donor. Vasorelaxant. Cytotoxic to cells that express GLUT2 glucose transporter. O-GlcNAc-selective N-acetyl-beta-D-glucosaminidase (O-GlcNAcase) inhibitor. Genotoxic. Induces DNA damage. Produces DNA strand breaks. Cell death inducer. Antineoplastic. Anti-cancer agent used in chemotherapy. Induces cell cylce arrest at G2.
| Catalog Number | AG-CN2-0046-G001 |
| Alternative Name(s) | 2-Deoxy-2-(3-methyl-3-nitrosoureido)-D-glucopyranose; Streptozocin; STZ; NSC 85998; Antibiotic U9889; Zanosar |
| Research Area | Cancer, Cell Death, Inflammation, Natural Products, Obesity |
| Molecular Formula | C8H15N3O7 |
| CAS# | 18883-66-4 |
| Purity | >98% |
| Inchi | InChI=1S/C8H15N3O7/c1-11(10-17)8(16)9-4-6(14)5(13)3(2-12)18-7(4)15/h3-7,12-15H,2H2,1H3,(H,9,16)/t3-,4-,5-,6-,7+/m1/s1 |
| Inchi Key | ZSJLQEPLLKMAKR-GKHCUFPYSA-N |
| SMILES | CN(N=O)C(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| Size | 1 g |
| Supplier Page | http://www.adipogen.com/ag-cn2-0046/streptozotocin.html |
