(R)-Roscovitine
Potent and selective inhibitor of CDKs. More potent than olomoucine. Inhibits CDK1/cyclin B kinase (IC50 = 450 nM), CDK2 (IC50 = 700 nM) and CDK5/p35 (IC50 = 160 nM). Inhibits M phase promoting factor (MPF) kinase activity. Arrests human fibroblasts in G1 phase. Antitumor compound. Activates the mitogen-activated protein kinase pathway. Targets both the p53 and NF-kappaB pathways[10]. Has effects on calcium channel gating. Prevents DNA damage-induced cyclin A1 upregulation. Apoptosis inducer. As CYC202 in phase I clinical trials. Reviews.
| Catalog Number | AG-CR1-0006-M050 |
| Alternative Name(s) | 6-Benzylamino-2-(R)-[(1-ethyl)-2-hydroxyethylamino]-9-isopropylpurine |
| Research Area | Biochemicals, Cancer |
| Molecular Formula | C19H26N6O |
| CAS# | 186692-46-6 |
| Purity | >98% |
| Inchi | InChI=1S/C19H26N6O/c1-4-15(11-26)22-19-23-17(20-10-14-8-6-5-7-9-14)16-18(24-19)25(12-21-16)13(2)3/h5-9,12-13,15,26H,4,10-11H2,1-3H3,(H2,20,22,23,24)/t15-/m1/s1 |
| Inchi Key | BTIHMVBBUGXLCJ-OAHLLOKOSA-N |
| SMILES | CC[C@H](CO)NC1=NC2=C(N=CN2C(C)C)C(NCC2=CC=CC=C2)=N1 |
| Size | 50 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-0006/-r-roscovitine.html |
