PS-341 [Bortezomib]
Highly potent, selective and reversible cell permeable inhibitor of the proteasome. Inhibits the chymotrypsin-like and caspase-like peptidase activity of the proteasome. Calpain and cathepsin inhibitor. Autophagy activator. Anticancer compound. Inhibits proliferation and migration of several tumor cell lines with nanomolar potency. Apoptosis inducer.
| Catalog Number | AG-CR1-3602-M025 |
| Alternative Name(s) | PS-341; LDP-341; MLM-341; MG-341; NSC-681239; Proteasome Inhibitor |
| Research Area | Biochemicals, Cancer, Metabolism, Neurobiology |
| Molecular Formula | C19H25BN4O4 |
| CAS# | 179324-69-7 |
| Purity | >97% |
| Inchi | InChI=1S/C19H25BN4O4/c1-13(2)10-17(20(27)28)24-18(25)15(11-14-6-4-3-5-7-14)23-19(26)16-12-21-8-9-22-16/h3-9,12-13,15,17,27-28H,10-11H2,1-2H3,(H,23,26)(H,24,25)/t15-,17-/m0/s1 |
| Inchi Key | GXJABQQUPOEUTA-RDJZCZTQSA-N |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C1=NC=CN=C1)B(O)O |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3602/bortezomib.html |
