PD 98,059
Highly selective, reversible and cell permeable MEK (MAP kinase kinase) inhibitor. Blocks the phosphorylation and activation of the MAP kinase pathway. T cell activation inhibitor. Inhibits cell growth and cell proliferation of several cancer cells.
| Catalog Number | AG-CR1-0118-M050 |
| Alternative Name(s) | 2'-Amino-3'-methoxyflavone |
| Research Area | Biochemicals, Cancer, Immunology |
| Molecular Formula | C16H13NO3 |
| CAS# | 167869-21-8 |
| Purity | >98% |
| Inchi | InChI=1S/C16H13NO3/c1-19-14-8-4-6-11(16(14)17)15-9-12(18)10-5-2-3-7-13(10)20-15/h2-9H,17H2,1H3 |
| Inchi Key | QFWCYNPOPKQOKV-UHFFFAOYSA-N |
| SMILES | COC1=C(N)C(=CC=C1)C1=CC(=O)C2=CC=CC=C2O1 |
| Size | 50 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-0118/pd-98-059.html |
